749 Ontology Annotations
| Class | GO Term | Gene Name | Db |
|---|---|---|---|
| GOAnnotation | GO:0003949 | 121182 | |
| OntologyAnnotation | GO:0003949 | 121182 | GO |
| GOAnnotation | GO:0003949 | Cucsa.237080 | |
| OntologyAnnotation | GO:0003949 | Cucsa.237130.6 | GO |
| OntologyAnnotation | GO:0003949 | Cucsa.237080.1 | GO |
| OntologyAnnotation | GO:0003949 | Cucsa.237090.2 | GO |
| OntologyAnnotation | GO:0003949 | Cucsa.237120.5 | GO |
| OntologyAnnotation | GO:0003949 | orange1.1g021156m | GO |
| GOAnnotation | GO:0003949 | orange1.1g021156m.g | |
| GOAnnotation | GO:0003949 | AT2G36230 | |
| OntologyAnnotation | GO:0003949 | AT2G36230.1 | GO |
| OntologyAnnotation | GO:0003949 | Thhalv10016966m | GO |
| GOAnnotation | GO:0003949 | Thhalv10016966m.g | |
| GOAnnotation | GO:0003949 | Ciclev10012240m.g | |
| OntologyAnnotation | GO:0003949 | Ciclev10012240m | GO |
| OntologyAnnotation | GO:0003949 | Lus10017042 | GO |
| GOAnnotation | GO:0003949 | Lus10017042.g | |
| OntologyAnnotation | GO:0003949 | Potri.004G090500.1 | GO |
| GOAnnotation | GO:0003949 | Potri.004G090500 | |
| OntologyAnnotation | GO:0003949 | Potri.017G124800.2 | GO |
| OntologyAnnotation | GO:0003949 | Potri.017G124800.1 | GO |
| GOAnnotation | GO:0003949 | Potri.017G124800 | |
| GOAnnotation | GO:0003949 | Gorai.009G402500 | |
| OntologyAnnotation | GO:0003949 | Gorai.009G402500.1 | GO |
| GOAnnotation | GO:0003949 | estExt_fgenesh1_pm.C_160082 | |
| OntologyAnnotation | GO:0003949 | 54436 | GO |
| OntologyAnnotation | GO:0003949 | 149503 | GO |
| GOAnnotation | GO:0003949 | e_gw1.1.2175.1 | |
| OntologyAnnotation | GO:0003949 | 50705 | GO |
| GOAnnotation | GO:0003949 | MicpuC2.EuGene.0000010929 |
8 Parents
| Identifier | Name | Description |
|---|---|---|
| GO:0003824 | catalytic activity | Catalysis of a biochemical reaction at physiological temperatures. In biologically catalyzed reactions, the reactants are known as substrates, and the catalysts are naturally occurring macromolecular substances known as enzymes. Enzymes possess specific binding sites for substrates, and are usually composed wholly or largely of protein, but RNA that has catalytic activity (ribozyme) is often also regarded as enzymatic. |
| GO:0008152 | metabolic process | The chemical reactions and pathways, including anabolism and catabolism, by which living organisms transform chemical substances. Metabolic processes typically transform small molecules, but also include macromolecular processes such as DNA repair and replication, and protein synthesis and degradation. |
| GO:0016853 | isomerase activity | Catalysis of the geometric or structural changes within one molecule. Isomerase is the systematic name for any enzyme of EC class 5. |
| GO:0003949 | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide isomerase activity | Catalysis of the reaction: 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide = 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide. |
| GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses | Catalysis of an oxidation-reduction (redox) reaction in which the hydrogen donor and acceptor, which is an aldose or a ketose, are the same molecule, and no oxidized product appears. |
| GO:0008150 | biological_process | Any process specifically pertinent to the functioning of integrated living units: cells, tissues, organs, and organisms. A process is a collection of molecular events with a defined beginning and end. |
| GO:0003674 | molecular_function | Elemental activities, such as catalysis or binding, describing the actions of a gene product at the molecular level. A given gene product may exhibit one or more molecular functions. |
| GO:0016860 | intramolecular oxidoreductase activity | Catalysis of an oxidation-reduction (redox) reaction in which the hydrogen donor and acceptor are the same molecule, and no oxidized product appears. |
7 Relations
| Relationship |
Parent Term . Identifier |
Child Term . Identifier |
|---|---|---|
| is_a | GO:0016861 | GO:0003949 |
| part of | GO:0008152 | GO:0003949 |
| is_a | GO:0016853 | GO:0003949 |
| is_a | GO:0003824 | GO:0003949 |
| is_a | GO:0003674 | GO:0003949 |
| is_a | GO:0016860 | GO:0003949 |
| part of | GO:0008150 | GO:0003949 |
6 Synonyms
| Name | Type |
|---|---|
| 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide aldose-ketose-isomerase activity | synonym |
| N-(5'-phospho-D-ribosylformimino)-5-amino-1-(5''-phosphoribosyl)-4-imidazolecarboxamide isomerase activity | synonym |
| 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide ketol-isomerase activity | synonym |
| phosphoribosylformimino-5-aminoimidazole carboxamide ribotide isomerase activity | synonym |
| N-(phosphoribosylformimino) aminophosphoribosylimidazolecarboxamide isomerase activity | synonym |
| phosphoribosylformiminoaminophosphoribosylimidazolecarboxamide isomerase activity | synonym |
